"ହାଇଡ୍ରୋମର୍ଫୋନ" ପୃଷ୍ଠାର ସଂସ୍କରଣ‌ଗୁଡ଼ିକ ମଧ୍ୟରେ ତଫାତ

ଡ୍ରଗ ବାକ୍ସ ଯୋଗ କରାଗଲା
(Created by translating the page "User:Mr. Ibrahem/Hydromorphone")
 
(ଡ୍ରଗ ବାକ୍ସ ଯୋଗ କରାଗଲା)
ଟ୍ୟାଗ: 2017 source edit
 {{drugbox
 
| Watchedfields = changed
| verifiedrevid = 464191262
| IUPAC_name = 4,5-α-Epoxy-3-hydroxy-17-methyl morphinan-6-one
| image = Hydromorphone skeletal.svg
| alt = Structural formula of hydromorphone
| width = 180
| image2 = Hydromorphone molecule spacefill.png
| alt2 = Space-filling model of hydromorphone
| width2 =
 
<!--Clinical data-->
 
| tradename = Dilaudid, Hydromorph Contin, Palladone, others
| Drugs.com = {{drugs.com|monograph|hydromorphone-hydrochloride}}
| MedlinePlus = a682013
| DailyMedID = Hydromorphone
| pregnancy_AU = C
| pregnancy_AU_comment = <ref name="Drugs.com pregnancy">{{cite web | title=Hydromorphone Use During Pregnancy | website=Drugs.com | date=19 November 2019 | url=https://www.drugs.com/pregnancy/hydromorphone.html | access-date=16 May 2020}}</ref>
| pregnancy_US = N
| pregnancy_US_comment = <ref name="Drugs.com pregnancy" />
| legal_AU = S8
| legal_CA = Schedule I
| legal_DE = Anlage III
| legal_NZ = Class B
| legal_US = Schedule II
| legal_UK = Class A
| legal_UK_comment = and Classified Drug
| legal_UN = N I
| legal_status =
| dependency_liability = High<ref>{{cite book |last1=Bonewit-West |first1=Kathy |last2=Hunt |first2=Sue A. |last3=Applegate |first3=Edith |title=Today's Medical Assistant: Clinical and Administrative Procedures |date=2012|page=571 |publisher=Elsevier Health Sciences |isbn=9781455701506 |url=https://books.google.com/books?id=YalYPI1KqTQC&pg=PA571 |language=en}}</ref>
| routes_of_administration = By mouth, intramuscular, intravenous, subcutaneous
| onset = 15 to 30 min<ref name=AHFS2019/>
| duration_of_action = 4 to 5 hrs<ref name=AHFS2019/>
 
<!--Pharmacokinetic data-->
| bioavailability = By mouth: 30–35%, Intranasal: 52–58%,<ref name="pmid12818953">{{cite journal |vauthors = Coda BA, Rudy AC, Archer SM, Wermeling DP |title = Pharmacokinetics and bioavailability of single-dose intranasal hydromorphone hydrochloride in healthy volunteers |journal = Anesth. Analg. |volume = 97 |issue = 1 |pages = 117–23, table of contents |date = July 2003 |pmid = 12818953 |doi = 10.1213/01.ANE.0000066311.40978.4F |citeseerx = 10.1.1.551.6509 |s2cid = 22694749 }}</ref> IV/IM: 100%
| protein_bound = 20%
| metabolism = Liver
| elimination_half-life = 2–3 hours<ref name="pmid6165742">{{cite journal |vauthors = Vallner JJ, Stewart JT, Kotzan JA, Kirsten EB, Honigberg IL |title = Pharmacokinetics and bioavailability of hydromorphone following intravenous and oral administration to human subjects |journal = J Clin Pharmacol |volume = 21 |issue = 4 |pages = 152–6 |date = April 1981 |pmid = 6165742 |doi = 10.1002/j.1552-4604.1981.tb05693.x |s2cid = 29864565 }}</ref>
| excretion = Kidney
<!--Identifiers-->
| IUPHAR_ligand = 7082
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 466-99-9
| ATC_prefix = N02
| ATC_suffix = AA03
| ATC_supplemental =
| PubChem = 5284570
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00327
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4447624
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q812464R06
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08047
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 5790
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 398707
 
<!--Chemical data-->
| C = 17| H = 19 | N = 1| O = 3
| smiles = O=C4[C@@H]5Oc1c2c(ccc1O)C[C@H]3N(CC[C@]25[C@H]3CC4)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,16,19H,3,5-8H2,1H3/t10-,11+,16-,17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WVLOADHCBXTIJK-YNHQPCIGSA-N
| synonyms = Dihydromorphinone
| solubility = [[hydrochloride|HCl salt]]: 333
}} 
 
'''ହାଇଡ୍ରୋମର୍ଫୋନ''' '''(ନାମ''' '''ଡିହାଇଡ୍ରୋମରଫିନନ, ବିକ୍ରୟ ନାମ''' ଡି'''ଲାଉଡିଡ୍)''' ହୋଇଥିଲା, ଏକ ଅଫିମ ଜାତୀୟ ଔଷଧ ଯାହା ମଧ୍ୟମରୁ ପ୍ରବଳ ଧରଣର [[ଯନ୍ତ୍ରଣା|ଯନ୍ତ୍ରଣାର]] ଚିକିତ୍ସା ପାଇଁ ବ୍ୟବହୃତ ହୁଏ | <ref name="AHFS2019">{{cite web |title=Hydromorphone Hydrochloride Monograph for Professionals |url=https://www.drugs.com/monograph/hydromorphone-hydrochloride.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |accessdate=15 April 2019 |language=en}}</ref> ଦୀର୍ଘକାଳୀନ [[କର୍କଟ ରୋଗ|କର୍କଟ]] ଯନ୍ତ୍ରଣା ପାଇଁ ଏହ ବ୍ୟବହାର କରିବାକୁ ସୁପାରିଶ କରାଯାଏ | <ref name="BNF76">{{Cite book|title=British national formulary: BNF 76|date=2018|publisher=Pharmaceutical Press|isbn=9780857113382|edition=76|pages=24, 456}}</ref> ଏହା ପାଟି ରେ ଦିଆଯାଏ କିମ୍ବା ମାଂସପେଶୀ, ଚର୍ମ ତଳେ ବା ଶିରାଭ୍ୟନ୍ତରରେ ଇଞ୍ଜେକ୍ସନ ଆକାରରେ ବ୍ୟବହୃତ ହୋଇପାରେ | <ref name="AHFS2019">{{cite web |title=Hydromorphone Hydrochloride Monograph for Professionals |url=https://www.drugs.com/monograph/hydromorphone-hydrochloride.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |accessdate=15 April 2019 |language=en}}</ref> ଏହାର ପ୍ରଭାବ ସାଧାରଣତଃ ଅଧ ଘଣ୍ଟା ମଧ୍ୟରେ ଆରମ୍ଭ ହୋଇ ପାଞ୍ଚ ଘଣ୍ଟା ପର୍ଯ୍ୟନ୍ତ ରହିଥାଏ | <ref name="AHFS2019">{{cite web |title=Hydromorphone Hydrochloride Monograph for Professionals |url=https://www.drugs.com/monograph/hydromorphone-hydrochloride.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |accessdate=15 April 2019 |language=en}}</ref>
୧୧,୮୫୭

ଗୋଟି ସମ୍ପାଦନା