"ସେଟିରିଜାଇନ" ପୃଷ୍ଠାର ସଂସ୍କରଣ‌ଗୁଡ଼ିକ ମଧ୍ୟରେ ତଫାତ

ଡ୍ରଗ ବାକ୍ସ ଯୋଗ କରାଗଲା
(Created by translating the page "User:Mr. Ibrahem/Cetirizine")
 
(ଡ୍ରଗ ବାକ୍ସ ଯୋଗ କରାଗଲା)
ଟ୍ୟାଗ: 2017 source edit
{{Drugbox
 
| Watchedfields = changed
<!--[[airbag]]-->
| verifiedrevid = 460026203
| IUPAC_name = (±)-[2-[4-[(4-Chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]acetic acid
| image = Cetirizine structure.svg
| width = 250px
| image2 = Cetirizine-ball-and-stick.png
| width2 = 250px
<!-- Clinical data -->
| pronounce = {{IPAc-en|s|ɛ|ˈ|t|ɪr|ᵻ|z|iː|n}}
| tradename = Zyrtec, Incidal, others
| Drugs.com = {{drugs.com|monograph|cetirizine-hydrochloride}}
| MedlinePlus = a698026
| DailyMedID = Cetirizine
| licence_EU =
| licence_US = Cetirizine
| pregnancy_AU = B2
| legal_UK = GSL
| legal_UK_comment = /&nbsp;P
| legal_US = OTC
| legal_US_comment = /&nbsp;Rx-only
| legal_AU = Unscheduled
| legal_CA = OTC
|legal_status=OTC
| routes_of_administration = [[Oral administration|By mouth]]
<!-- Pharmacokinetic data -->
| bioavailability = Well-absorbed (>70%)<ref name="pmid18781943">{{cite journal | vauthors = Chen C | title = Physicochemical, pharmacological and pharmacokinetic properties of the zwitterionic antihistamines cetirizine and levocetirizine | journal = Curr. Med. Chem. | volume = 15 | issue = 21 | pages = 2173–91 | year = 2008 | pmid = 18781943 | doi = 10.2174/092986708785747625}}</ref>
| protein_bound = 88–96%<ref name="pmid18781943" />
| metabolism = Minimal (non-[[cytochrome P450]]-mediated)<ref name="pmid14680442" /><ref name="pmid10384858" />
| onset = 20–42 minutes<ref name="pmid10384858" />
| elimination_half-life = Mean: 8.3 hours<ref name="pmid14680442" /><ref name="pmid10384858" /><br />Range: 6.5–10 hours<ref name="pmid12517581">{{cite journal | vauthors = Simons FE | title = Comparative pharmacology of H1 antihistamines: clinical relevance | journal = Am. J. Med. | volume = 113 Suppl 9A | issue = 9| pages = 38S–46S | year = 2002 | pmid = 12517581 | doi = 10.1016/s0002-9343(02)01436-5}}</ref>
| duration_of_action = ≥24 hours<ref name="pmid12517581" />
| excretion = [[Urine]]: 70–85%<ref name="pmid14680442" /><br />[[Feces]]: 10–13%<ref name="pmid14680442" />
<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 83881-51-0
| ATC_prefix = R06
| ATC_suffix = AE07
| PubChem = 2678
| IUPHAR_ligand = 1222
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00341
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2577
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = YO7261ME24
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07662
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3561
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1000
<!-- Chemical data -->
| C=21 | H=25 | Cl=1 | N=2 | O=3
| SMILES = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)CCOCC(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZKLPARSLTMPFCP-UHFFFAOYSA-N
| synonyms =
}}
 
 
'''ସେଟିରିଜାଇନ,''' ବିକ୍ରୟ ନାମ ଅନ୍ୟମାନଙ୍କ ମଧ୍ୟରେ '''ଜିରଟେକ୍,''' ଏକ ଆଣ୍ଟିହିଷ୍ଟାମିନ ଔଷଧ '''ଯାହା''' [[ଆଲର୍ଜିକ ନାକ ପ୍ରଦାହ|ଆଲର୍ଜିକ ନାକ ପ୍ରଦାହ,]] (ଘାସ ଜ୍ୱର), [[ଚର୍ମ ପ୍ରଦାହ]] ଏବଂ ଅର୍ଟିକାରିଆ ରୋଗମାନଙ୍କର ଚିକିତ୍ସା ପାଇଁ ବ୍ୟବହୃତ ହୁଏ | <ref name="BNF76">{{Cite book|title=British national formulary : BNF 76|date=2018|publisher=Pharmaceutical Press|isbn=9780857113382|edition=76|pages=279}}</ref> ଏହା ପାଟି ଦ୍ୱାରା ନିଆଯାଏ | <ref name="AHFS2019">{{Cite web|url=https://www.drugs.com/monograph/cetirizine-hydrochloride.html|title=Cetirizine Hydrochloride Monograph for Professionals|website=Drugs.com|publisher=American Society of Health-System Pharmacists|language=en|access-date=3 March 2019}}</ref> ପ୍ରଭାବ ସାଧାରଣତ an ଏକ ଘଣ୍ଟା ମଧ୍ୟରେ ଆରମ୍ଭ ହୋଇ ପ୍ରାୟ ଏକ ଦିନ ପର୍ଯ୍ୟନ୍ତ ରହିଥାଏ | <ref name="AHFS2019">{{cite web |title=Cetirizine Hydrochloride Monograph for Professionals |url=https://www.drugs.com/monograph/cetirizine-hydrochloride.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |accessdate=3 March 2019 |language=en}}</ref> ଲାଭର ଡିଗ୍ରୀ ଅନ୍ୟ ଆଣ୍ଟିହାଇଷ୍ଟାମାଇନ୍ ଯେପରିକି [[ଡାଇଫେନହାଇଡ୍ରାମିନ|ଡିଫେନ୍ହାଇଡ୍ରାମାଇନ୍ ସହିତ ସମାନ]] | <ref name="AHFS2019">{{cite web |title=Cetirizine Hydrochloride Monograph for Professionals |url=https://www.drugs.com/monograph/cetirizine-hydrochloride.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |accessdate=3 March 2019 |language=en}}</ref>
 
୧୧,୮୫୭

ଗୋଟି ସମ୍ପାଦନା