"ଡାଏଜୋକ୍ସାଇଡ" ପୃଷ୍ଠାର ସଂସ୍କରଣ‌ଗୁଡ଼ିକ ମଧ୍ୟରେ ତଫାତ

ଡ୍ରଗ ବାକ୍ସ ଯୋଗ କରାଗଲା
(Created by translating the page "User:Mr. Ibrahem/Diazoxide")
 
(ଡ୍ରଗ ବାକ୍ସ ଯୋଗ କରାଗଲା)
ଟ୍ୟାଗ: 2017 source edit
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 460781978
| IUPAC_name = 7-Chloro-3-methyl-4''H''-1,2,4-benzothiadiazine 1,1-dioxide
| image = Diazoxide Structural Formula V.1.svg
<!--Clinical data-->
| tradename = Proglycem, Balila
| Drugs.com = {{drugs.com|monograph|diazoxide}}
| DailyMedID = Diazoxide
| pregnancy_AU = C
| pregnancy_US = C
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = By mouth, [[Intravenous therapy|intravenous]]
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound = 90%
| metabolism = [[Liver]] [[oxidation]] and [[sulfate]] conjugation
| elimination_half-life = 21-45 hours
| excretion = [[Kidney]]
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 364-98-7
| ATC_prefix = C02
| ATC_suffix = DA01
| ATC_supplemental = {{ATC|V03|AH01}}
| PubChem = 3019
| IUPHAR_ligand = 2409
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01119
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2911
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O5CB12L4FN
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00294
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 4495
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 181
<!--Chemical data-->
| C=8 | H=7 | Cl=1 | N=2 | O=2 | S=1
| smiles = Clc1ccc2c(c1)S(=O)(=O)/N=C(\N2)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C8H7ClN2O2S/c1-5-10-7-3-2-6(9)4-8(7)14(12,13)11-5/h2-4H,1H3,(H,10,11)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GDLBFKVLRPITMI-UHFFFAOYSA-N
| melting_point = 330
| melting_high = 331
}}
 
'''ଡାଏଜୋକ୍ସାଇଡ,''' (ବ୍ରାଣ୍ଡ ନାମ ପ୍ରୋଗ୍ଲାଇସେମ/ '''Proglycem) ଏକ ଔଷଧ ଯାହା ବିଭିନ୍ନ କାରଣରୁ ଜାତ ହେଉଥିବା''' [[ନିମ୍ନ ରକ୍ତ ଶର୍କରା]] ସ୍ତରର ଚିକିତ୍ସା ନିମନ୍ତେ ଦିଆଯାଏ । <ref name="AHFS2019">{{Cite web|url=https://www.drugs.com/monograph/diazoxide.html|title=Diazoxide Monograph for Professionals|website=Drugs.com|language=en|access-date=11 October 2019}}</ref> ଏଥିରେ ଅପସାରଣ ଅକ୍ଷମ ଆଇଲେଟ ଜୀବକୋଷ ଅର୍ବୁଦ ଓ ଲିଉସିନ ସମ୍ବେଦନଶୀଳ କାରଣ ଥାଇପାରେ । <ref name="AHFS2019">{{cite web |title=Diazoxide Monograph for Professionals |url=https://www.drugs.com/monograph/diazoxide.html |website=Drugs.com |accessdate=11 October 2019 |language=en}}</ref> ଏହା ଅମାନିଆ ସଲଫୋନିଲୁରିଆ ବିଷର ଚିକିତ୍ସାରେ ମଧ୍ୟ ଦିଆଯାଏ । <ref name="Review2003">{{Cite journal|last=Doyle|first=Máire E.|last2=Egan|first2=Josephine M.|date=2003-03-01|title=Pharmacological Agents That Directly Modulate Insulin Secretion|journal=Pharmacological Reviews|language=en|volume=55|issue=1|pages=105–131|doi=10.1124/pr.55.1.7|issn=1521-0081|pmid=12615955}}</ref> ଏହା ସାଧାରଣତଃ ପାଟିରେ ଦିଆଯାଏ | <ref name="AHFS2019">{{cite web |title=Diazoxide Monograph for Professionals |url=https://www.drugs.com/monograph/diazoxide.html |website=Drugs.com |accessdate=11 October 2019 |language=en}}</ref>
 
୧୧,୯୨୯

ଗୋଟି ସମ୍ପାଦନା